C12H17N3O2S2 — CID 53072000
1-(1-thiophen-2-ylsulfonyl-4,5-dihydroimidazol-2-yl)piperidine (PubChem CID 53072000) has the molecular formula C12H17N3O2S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-(1-thiophen-2-ylsulfonyl-4,5-dihydroimidazol-2-yl)piperidine.
| Compound Name | 1-(1-thiophen-2-ylsulfonyl-4,5-dihydroimidazol-2-yl)piperidine |
|---|---|
| PubChem CID | 53072000 |
| Molecular Formula | C12H17N3O2S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-(1-thiophen-2-ylsulfonyl-4,5-dihydroimidazol-2-yl)piperidine |
| SMILES | O=S(=O)(c1cccs1)N1CCN=C1N1CCCCC1 |
| InChI | InChI=1S/C12H17N3O2S2/c16-19(17,11-5-4-10-18-11)15-9-6-13-12(15)14-7-2-1-3-8-14/h4-5,10H,1-3,6-9H2 |
| InChIKey | XUOQZOIWPCCWSL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |