C14H15NO3S2 — CID 104538378
1-thiophen-2-ylsulfonyl-2,3,4,5-tetrahydro-1-benzazepin-5-ol (PubChem CID 104538378) has the molecular formula C14H15NO3S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-thiophen-2-ylsulfonyl-2,3,4,5-tetrahydro-1-benzazepin-5-ol.
| Compound Name | 1-thiophen-2-ylsulfonyl-2,3,4,5-tetrahydro-1-benzazepin-5-ol |
|---|---|
| PubChem CID | 104538378 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 1-thiophen-2-ylsulfonyl-2,3,4,5-tetrahydro-1-benzazepin-5-ol |
| SMILES | O=S(=O)(c1cccs1)N1CCCC(O)c2ccccc21 |
| InChI | InChI=1S/C14H15NO3S2/c16-13-7-3-9-15(12-6-2-1-5-11(12)13)20(17,18)14-8-4-10-19-14/h1-2,4-6,8,10,13,16H,3,7,9H2 |
| InChIKey | AQNIOLKPWRIINK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |