C15H15NO4S2 — CID 110672703
methyl 2-(1-thiophen-2-ylsulfonyl-2,3-dihydroindol-3-yl)acetate (PubChem CID 110672703) has the molecular formula C15H15NO4S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl 2-(1-thiophen-2-ylsulfonyl-2,3-dihydroindol-3-yl)acetate.
| Compound Name | methyl 2-(1-thiophen-2-ylsulfonyl-2,3-dihydroindol-3-yl)acetate |
|---|---|
| PubChem CID | 110672703 |
| Molecular Formula | C15H15NO4S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | methyl 2-(1-thiophen-2-ylsulfonyl-2,3-dihydroindol-3-yl)acetate |
| SMILES | COC(=O)CC1CN(S(=O)(=O)c2cccs2)c2ccccc21 |
| InChI | InChI=1S/C15H15NO4S2/c1-20-14(17)9-11-10-16(13-6-3-2-5-12(11)13)22(18,19)15-7-4-8-21-15/h2-8,11H,9-10H2,1H3 |
| InChIKey | GGGQMDADUSHALB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |