C14H15NO4S2 — CID 110637194
7-methoxy-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-4-ol (PubChem CID 110637194) has the molecular formula C14H15NO4S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 7-methoxy-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-4-ol.
| Compound Name | 7-methoxy-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-4-ol |
|---|---|
| PubChem CID | 110637194 |
| Molecular Formula | C14H15NO4S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 7-methoxy-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-4-ol |
| SMILES | COc1ccc2c(c1)N(S(=O)(=O)c1cccs1)CCC2O |
| InChI | InChI=1S/C14H15NO4S2/c1-19-10-4-5-11-12(9-10)15(7-6-13(11)16)21(17,18)14-3-2-8-20-14/h2-5,8-9,13,16H,6-7H2,1H3 |
| InChIKey | IABLQPSLPWFJOW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |