C13H12ClNO3S2 — CID 110636432
6-chloro-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-4-ol (PubChem CID 110636432) has the molecular formula C13H12ClNO3S2 and a molecular weight of 329.83 g/mol. Its IUPAC name is 6-chloro-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-4-ol.
| Compound Name | 6-chloro-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-4-ol |
|---|---|
| PubChem CID | 110636432 |
| Molecular Formula | C13H12ClNO3S2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 6-chloro-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-4-ol |
| SMILES | O=S(=O)(c1cccs1)N1CCC(O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C13H12ClNO3S2/c14-9-3-4-11-10(8-9)12(16)5-6-15(11)20(17,18)13-2-1-7-19-13/h1-4,7-8,12,16H,5-6H2 |
| InChIKey | AVDSYVKYSRWQAW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |