C15H14ClNO3S — CID 110636408
1-(benzenesulfonyl)-6-chloro-3,4-dihydro-2H-quinolin-4-ol (PubChem CID 110636408) has the molecular formula C15H14ClNO3S and a molecular weight of 323.80 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-6-chloro-3,4-dihydro-2H-quinolin-4-ol.
| Compound Name | 1-(benzenesulfonyl)-6-chloro-3,4-dihydro-2H-quinolin-4-ol |
|---|---|
| PubChem CID | 110636408 |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1-(benzenesulfonyl)-6-chloro-3,4-dihydro-2H-quinolin-4-ol |
| SMILES | O=S(=O)(c1ccccc1)N1CCC(O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H14ClNO3S/c16-11-6-7-14-13(10-11)15(18)8-9-17(14)21(19,20)12-4-2-1-3-5-12/h1-7,10,15,18H,8-9H2 |
| InChIKey | ZFLOIDNGPLVDJA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |