C17H18ClNO5S — CID 110636425
6-chloro-1-(3,4-dimethoxyphenyl)sulfonyl-3,4-dihydro-2H-quinolin-4-ol (PubChem CID 110636425) has the molecular formula C17H18ClNO5S and a molecular weight of 383.85 g/mol. Its IUPAC name is 6-chloro-1-(3,4-dimethoxyphenyl)sulfonyl-3,4-dihydro-2H-quinolin-4-ol.
| Compound Name | 6-chloro-1-(3,4-dimethoxyphenyl)sulfonyl-3,4-dihydro-2H-quinolin-4-ol |
|---|---|
| PubChem CID | 110636425 |
| Molecular Formula | C17H18ClNO5S |
| Molecular Weight | 383.85 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 6-chloro-1-(3,4-dimethoxyphenyl)sulfonyl-3,4-dihydro-2H-quinolin-4-ol |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(O)c3cc(Cl)ccc32)cc1OC |
| InChI | InChI=1S/C17H18ClNO5S/c1-23-16-6-4-12(10-17(16)24-2)25(21,22)19-8-7-15(20)13-9-11(18)3-5-14(13)19/h3-6,9-10,15,20H,7-8H2,1-2H3 |
| InChIKey | RHOQNCNRHJSOKJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.85 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |