C13H19NO3S2 — CID 79543711
2-(1-thiophen-2-ylsulfonylpyrrolidin-2-yl)cyclopentan-1-ol (PubChem CID 79543711) has the molecular formula C13H19NO3S2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-(1-thiophen-2-ylsulfonylpyrrolidin-2-yl)cyclopentan-1-ol.
| Compound Name | 2-(1-thiophen-2-ylsulfonylpyrrolidin-2-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 79543711 |
| Molecular Formula | C13H19NO3S2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-(1-thiophen-2-ylsulfonylpyrrolidin-2-yl)cyclopentan-1-ol |
| SMILES | O=S(=O)(c1cccs1)N1CCCC1C1CCCC1O |
| InChI | InChI=1S/C13H19NO3S2/c15-12-6-1-4-10(12)11-5-2-8-14(11)19(16,17)13-7-3-9-18-13/h3,7,9-12,15H,1-2,4-6,8H2 |
| InChIKey | QMEPLAVZUHHKGU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |