C13H19N3O4S2 — CID 94799719
(2R)-N-(2-acetamidoethyl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 94799719) has the molecular formula C13H19N3O4S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is (2R)-N-(2-acetamidoethyl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(2-acetamidoethyl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 94799719 |
| Molecular Formula | C13H19N3O4S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | (2R)-N-(2-acetamidoethyl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CC(=O)NCCNC(=O)[C@H]1CCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H19N3O4S2/c1-10(17)14-6-7-15-13(18)11-4-2-8-16(11)22(19,20)12-5-3-9-21-12/h3,5,9,11H,2,4,6-8H2,1H3,(H,14,17)(H,15,18)/t11-/m1/s1 |
| InChIKey | JJFUACIACOOJCJ-LLVKDONJSA-N |
| XLogP | 0.15 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|