C15H22N2O5S2 — CID 119363680
(2R)-4-methyl-2-[(1-thiophen-2-ylsulfonylpyrrolidine-2-carbonyl)amino]pentanoic acid (PubChem CID 119363680) has the molecular formula C15H22N2O5S2 and a molecular weight of 374.48 g/mol. Its IUPAC name is (2R)-4-methyl-2-[(1-thiophen-2-ylsulfonylpyrrolidine-2-carbonyl)amino]pentanoic acid.
| Compound Name | (2R)-4-methyl-2-[(1-thiophen-2-ylsulfonylpyrrolidine-2-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 119363680 |
| Molecular Formula | C15H22N2O5S2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (2R)-4-methyl-2-[(1-thiophen-2-ylsulfonylpyrrolidine-2-carbonyl)amino]pentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)C1CCCN1S(=O)(=O)c1cccs1)C(=O)O |
| InChI | InChI=1S/C15H22N2O5S2/c1-10(2)9-11(15(19)20)16-14(18)12-5-3-7-17(12)24(21,22)13-6-4-8-23-13/h4,6,8,10-12H,3,5,7,9H2,1-2H3,(H,16,18)(H,19,20)/t11-,12?/m1/s1 |
| InChIKey | NMVDJQBWOHXORU-JHJMLUEUSA-N |
| XLogP | 1.52 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |