C14H23N3O3S2 — CID 95273287
(2S)-N-[(2R)-2-(dimethylamino)propyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 95273287) has the molecular formula C14H23N3O3S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (2S)-N-[(2R)-2-(dimethylamino)propyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2R)-2-(dimethylamino)propyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95273287 |
| Molecular Formula | C14H23N3O3S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (2S)-N-[(2R)-2-(dimethylamino)propyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | C[C@H](CNC(=O)[C@@H]1CCCN1S(=O)(=O)c1cccs1)N(C)C |
| InChI | InChI=1S/C14H23N3O3S2/c1-11(16(2)3)10-15-14(18)12-6-4-8-17(12)22(19,20)13-7-5-9-21-13/h5,7,9,11-12H,4,6,8,10H2,1-3H3,(H,15,18)/t11-,12+/m1/s1 |
| InChIKey | SGRPUXIWBGNKFY-NEPJUHHUSA-N |
| XLogP | 0.97 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |