C15H20N4O3S2 — CID 52512502
(2R)-N-[2-(1-methylpyrazol-4-yl)ethyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 52512502) has the molecular formula C15H20N4O3S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is (2R)-N-[2-(1-methylpyrazol-4-yl)ethyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[2-(1-methylpyrazol-4-yl)ethyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 52512502 |
| Molecular Formula | C15H20N4O3S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (2R)-N-[2-(1-methylpyrazol-4-yl)ethyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | Cn1cc(CCNC(=O)[C@H]2CCCN2S(=O)(=O)c2cccs2)cn1 |
| InChI | InChI=1S/C15H20N4O3S2/c1-18-11-12(10-17-18)6-7-16-15(20)13-4-2-8-19(13)24(21,22)14-5-3-9-23-14/h3,5,9-11,13H,2,4,6-8H2,1H3,(H,16,20)/t13-/m1/s1 |
| InChIKey | FSCIUIDTAKNAKU-CYBMUJFWSA-N |
| XLogP | 0.99 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |