C15H23N3O3S2 — CID 119533743
N-(2-pyrrolidin-3-ylethyl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 119533743) has the molecular formula C15H23N3O3S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-(2-pyrrolidin-3-ylethyl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-(2-pyrrolidin-3-ylethyl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119533743 |
| Molecular Formula | C15H23N3O3S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-(2-pyrrolidin-3-ylethyl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(NCCC1CCNC1)C1CCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H23N3O3S2/c19-15(17-8-6-12-5-7-16-11-12)13-3-1-9-18(13)23(20,21)14-4-2-10-22-14/h2,4,10,12-13,16H,1,3,5-9,11H2,(H,17,19) |
| InChIKey | YJRUFSWLXWRSJC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |