C16H25N3O3S2 — CID 119555303
N-(2-piperidin-3-ylethyl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 119555303) has the molecular formula C16H25N3O3S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-(2-piperidin-3-ylethyl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-(2-piperidin-3-ylethyl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119555303 |
| Molecular Formula | C16H25N3O3S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-(2-piperidin-3-ylethyl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(NCCC1CCCNC1)C1CCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H25N3O3S2/c20-16(18-9-7-13-4-1-8-17-12-13)14-5-2-10-19(14)24(21,22)15-6-3-11-23-15/h3,6,11,13-14,17H,1-2,4-5,7-10,12H2,(H,18,20) |
| InChIKey | WSLMCWXTHGUPRT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |