C14H22ClN3O3S2 — CID 119386114
N-piperidin-4-yl-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119386114) has the molecular formula C14H22ClN3O3S2 and a molecular weight of 379.94 g/mol. Its IUPAC name is N-piperidin-4-yl-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-piperidin-4-yl-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119386114 |
| Molecular Formula | C14H22ClN3O3S2 |
| Molecular Weight | 379.94 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-piperidin-4-yl-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCNCC1)C1CCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H21N3O3S2.ClH/c18-14(16-11-5-7-15-8-6-11)12-3-1-9-17(12)22(19,20)13-4-2-10-21-13;/h2,4,10-12,15H,1,3,5-9H2,(H,16,18);1H |
| InChIKey | SRDJRZJCDHFAJB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.94 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |