C14H15N3O3S2 — CID 94799494
(2R)-N-pyridin-2-yl-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 94799494) has the molecular formula C14H15N3O3S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is (2R)-N-pyridin-2-yl-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-pyridin-2-yl-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 94799494 |
| Molecular Formula | C14H15N3O3S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | (2R)-N-pyridin-2-yl-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccccn1)[C@H]1CCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H15N3O3S2/c18-14(16-12-6-1-2-8-15-12)11-5-3-9-17(11)22(19,20)13-7-4-10-21-13/h1-2,4,6-8,10-11H,3,5,9H2,(H,15,16,18)/t11-/m1/s1 |
| InChIKey | SIROZPXNMNVRTD-LLVKDONJSA-N |
| XLogP | 1.93 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |