C21H27N3O3S2 — CID 56555653
N-[4-(cyclopentylmethylamino)phenyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 56555653) has the molecular formula C21H27N3O3S2 and a molecular weight of 433.60 g/mol. Its IUPAC name is N-[4-(cyclopentylmethylamino)phenyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[4-(cyclopentylmethylamino)phenyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56555653 |
| Molecular Formula | C21H27N3O3S2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N-[4-(cyclopentylmethylamino)phenyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(NCC2CCCC2)cc1)C1CCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C21H27N3O3S2/c25-21(19-7-3-13-24(19)29(26,27)20-8-4-14-28-20)23-18-11-9-17(10-12-18)22-15-16-5-1-2-6-16/h4,8-12,14,16,19,22H,1-3,5-7,13,15H2,(H,23,25) |
| InChIKey | RTEKPSXIGHBYBV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |