C18H17N3O5S2 — CID 16830717
N-(2-methyl-1,3-dioxoisoindol-5-yl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 16830717) has the molecular formula C18H17N3O5S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 16830717 |
| Molecular Formula | C18H17N3O5S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)C3CCCN3S(=O)(=O)c3cccs3)cc2C1=O |
| InChI | InChI=1S/C18H17N3O5S2/c1-20-17(23)12-7-6-11(10-13(12)18(20)24)19-16(22)14-4-2-8-21(14)28(25,26)15-5-3-9-27-15/h3,5-7,9-10,14H,2,4,8H2,1H3,(H,19,22) |
| InChIKey | MPPRMNZWGVYVSN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|