C16H20N4O2S2 — CID 131655186
9-pyrimidin-2-yl-2-thiophen-2-ylsulfonyl-2,9-diazaspiro[4.5]decane (PubChem CID 131655186) has the molecular formula C16H20N4O2S2 and a molecular weight of 364.50 g/mol. Its IUPAC name is 9-pyrimidin-2-yl-2-thiophen-2-ylsulfonyl-2,9-diazaspiro[4.5]decane.
| Compound Name | 9-pyrimidin-2-yl-2-thiophen-2-ylsulfonyl-2,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 131655186 |
| Molecular Formula | C16H20N4O2S2 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 9-pyrimidin-2-yl-2-thiophen-2-ylsulfonyl-2,9-diazaspiro[4.5]decane |
| SMILES | O=S(=O)(c1cccs1)N1CCC2(CCCN(c3ncccn3)C2)C1 |
| InChI | InChI=1S/C16H20N4O2S2/c21-24(22,14-4-1-11-23-14)20-10-6-16(13-20)5-2-9-19(12-16)15-17-7-3-8-18-15/h1,3-4,7-8,11H,2,5-6,9-10,12-13H2 |
| InChIKey | VRHIHZRSOFDMGN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |