C14H22N4O2S — CID 97450240
(5S)-2-ethylsulfonyl-9-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane (PubChem CID 97450240) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is (5S)-2-ethylsulfonyl-9-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane.
| Compound Name | (5S)-2-ethylsulfonyl-9-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 97450240 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (5S)-2-ethylsulfonyl-9-pyrimidin-2-yl-2,9-diazaspiro[4.5]decane |
| SMILES | CCS(=O)(=O)N1CC[C@]2(CCCN(c3ncccn3)C2)C1 |
| InChI | InChI=1S/C14H22N4O2S/c1-2-21(19,20)18-10-6-14(12-18)5-3-9-17(11-14)13-15-7-4-8-16-13/h4,7-8H,2-3,5-6,9-12H2,1H3/t14-/m0/s1 |
| InChIKey | DRBDABWEWYXSFO-AWEZNQCLSA-N |
| XLogP | 1.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |