C12H14N2O2S3 — CID 91601557
2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)-1,3-thiazole (PubChem CID 91601557) has the molecular formula C12H14N2O2S3 and a molecular weight of 314.46 g/mol. Its IUPAC name is 2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)-1,3-thiazole.
| Compound Name | 2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 91601557 |
| Molecular Formula | C12H14N2O2S3 |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)-1,3-thiazole |
| SMILES | O=S(=O)(c1cccs1)N1CCC(c2nccs2)CC1 |
| InChI | InChI=1S/C12H14N2O2S3/c15-19(16,11-2-1-8-17-11)14-6-3-10(4-7-14)12-13-5-9-18-12/h1-2,5,8-10H,3-4,6-7H2 |
| InChIKey | YZSWVBQIFDPXSV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |