C19H21ClN2O2S — CID 110316048
1-[(2-chlorophenyl)methylsulfonyl]-5-pyrrolidin-1-yl-2,3-dihydroindole (PubChem CID 110316048) has the molecular formula C19H21ClN2O2S and a molecular weight of 376.91 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methylsulfonyl]-5-pyrrolidin-1-yl-2,3-dihydroindole.
| Compound Name | 1-[(2-chlorophenyl)methylsulfonyl]-5-pyrrolidin-1-yl-2,3-dihydroindole |
|---|---|
| PubChem CID | 110316048 |
| Molecular Formula | C19H21ClN2O2S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 1-[(2-chlorophenyl)methylsulfonyl]-5-pyrrolidin-1-yl-2,3-dihydroindole |
| SMILES | O=S(=O)(Cc1ccccc1Cl)N1CCc2cc(N3CCCC3)ccc21 |
| InChI | InChI=1S/C19H21ClN2O2S/c20-18-6-2-1-5-16(18)14-25(23,24)22-12-9-15-13-17(7-8-19(15)22)21-10-3-4-11-21/h1-2,5-8,13H,3-4,9-12,14H2 |
| InChIKey | XEWMMAUJANIGKT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|