C17H19ClN3O3S+ — CID 20734109
[2-[(2-chlorophenyl)methylsulfonyl]-4-morpholin-4-ylphenyl]iminoazanium (PubChem CID 20734109) has the molecular formula C17H19ClN3O3S+ and a molecular weight of 380.88 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methylsulfonyl]-4-morpholin-4-ylphenyl]iminoazanium.
| Compound Name | [2-[(2-chlorophenyl)methylsulfonyl]-4-morpholin-4-ylphenyl]iminoazanium |
|---|---|
| PubChem CID | 20734109 |
| Molecular Formula | C17H19ClN3O3S+ |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [2-[(2-chlorophenyl)methylsulfonyl]-4-morpholin-4-ylphenyl]iminoazanium |
| SMILES | [NH2+]=Nc1ccc(N2CCOCC2)cc1S(=O)(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C17H18ClN3O3S/c18-15-4-2-1-3-13(15)12-25(22,23)17-11-14(5-6-16(17)20-19)21-7-9-24-10-8-21/h1-6,11,19H,7-10,12H2/p+1 |
| InChIKey | DIECTMJTMCDLJB-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|