C22H31ClN3O2S+ — CID 20734103
[2-[(2-chlorophenyl)methylsulfonyl]-4-[2-ethylhexyl(methyl)amino]phenyl]iminoazanium (PubChem CID 20734103) has the molecular formula C22H31ClN3O2S+ and a molecular weight of 437.03 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methylsulfonyl]-4-[2-ethylhexyl(methyl)amino]phenyl]iminoazanium.
| Compound Name | [2-[(2-chlorophenyl)methylsulfonyl]-4-[2-ethylhexyl(methyl)amino]phenyl]iminoazanium |
|---|---|
| PubChem CID | 20734103 |
| Molecular Formula | C22H31ClN3O2S+ |
| Molecular Weight | 437.03 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | [2-[(2-chlorophenyl)methylsulfonyl]-4-[2-ethylhexyl(methyl)amino]phenyl]iminoazanium |
| SMILES | CCCCC(CC)CN(C)c1ccc(N=[NH2+])c(S(=O)(=O)Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H30ClN3O2S/c1-4-6-9-17(5-2)15-26(3)19-12-13-21(25-24)22(14-19)29(27,28)16-18-10-7-8-11-20(18)23/h7-8,10-14,17,24H,4-6,9,15-16H2,1-3H3/p+1 |
| InChIKey | CMSYODOPQJWJPW-UHFFFAOYSA-O |
| XLogP | 4.81 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.03 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|