C21H38N2O2S — CID 144577375
2-amino-N-(2-ethylhexyl)-N-heptan-3-ylbenzenesulfonamide (PubChem CID 144577375) has the molecular formula C21H38N2O2S and a molecular weight of 382.61 g/mol. Its IUPAC name is 2-amino-N-(2-ethylhexyl)-N-heptan-3-ylbenzenesulfonamide.
| Compound Name | 2-amino-N-(2-ethylhexyl)-N-heptan-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 144577375 |
| Molecular Formula | C21H38N2O2S |
| Molecular Weight | 382.61 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 2-amino-N-(2-ethylhexyl)-N-heptan-3-ylbenzenesulfonamide |
| SMILES | CCCCC(CC)CN(C(CC)CCCC)S(=O)(=O)c1ccccc1N |
| InChI | InChI=1S/C21H38N2O2S/c1-5-9-13-18(7-3)17-23(19(8-4)14-10-6-2)26(24,25)21-16-12-11-15-20(21)22/h11-12,15-16,18-19H,5-10,13-14,17,22H2,1-4H3 |
| InChIKey | AOZUHBDUCXJTMJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|