C22H41N3 — CID 174302535
3-N,3-N-bis(2-ethylhexyl)benzene-1,2,3-triamine (PubChem CID 174302535) has the molecular formula C22H41N3 and a molecular weight of 347.59 g/mol. Its IUPAC name is 3-N,3-N-bis(2-ethylhexyl)benzene-1,2,3-triamine.
| Compound Name | 3-N,3-N-bis(2-ethylhexyl)benzene-1,2,3-triamine |
|---|---|
| PubChem CID | 174302535 |
| Molecular Formula | C22H41N3 |
| Molecular Weight | 347.59 g/mol |
| Exact Mass | 347.33 |
| IUPAC Name | 3-N,3-N-bis(2-ethylhexyl)benzene-1,2,3-triamine |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1cccc(N)c1N |
| InChI | InChI=1S/C22H41N3/c1-5-9-12-18(7-3)16-25(17-19(8-4)13-10-6-2)21-15-11-14-20(23)22(21)24/h11,14-15,18-19H,5-10,12-13,16-17,23-24H2,1-4H3 |
| InChIKey | USCSLKJJXYBPBJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.59 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|