C23H29ClN3O2S+ — CID 72510780
2-[2-(2-chlorophenyl)ethenylsulfonyl]-4-[2-ethylhexyl(methyl)amino]benzenediazonium (PubChem CID 72510780) has the molecular formula C23H29ClN3O2S+ and a molecular weight of 447.02 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)ethenylsulfonyl]-4-[2-ethylhexyl(methyl)amino]benzenediazonium.
| Compound Name | 2-[2-(2-chlorophenyl)ethenylsulfonyl]-4-[2-ethylhexyl(methyl)amino]benzenediazonium |
|---|---|
| PubChem CID | 72510780 |
| Molecular Formula | C23H29ClN3O2S+ |
| Molecular Weight | 447.02 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-[2-(2-chlorophenyl)ethenylsulfonyl]-4-[2-ethylhexyl(methyl)amino]benzenediazonium |
| SMILES | CCCCC(CC)CN(C)c1ccc([N+]#N)c(S(=O)(=O)C=Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C23H29ClN3O2S/c1-4-6-9-18(5-2)17-27(3)20-12-13-22(26-25)23(16-20)30(28,29)15-14-19-10-7-8-11-21(19)24/h7-8,10-16,18H,4-6,9,17H2,1-3H3/q+1 |
| InChIKey | LQNGCOQBLLAAAJ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 65.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.02 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|