C18H28ClNO — CID 98523239
(Z,3R,4R)-1-(2-chlorophenyl)-4-[(dimethylamino)methyl]non-1-en-3-ol (PubChem CID 98523239) has the molecular formula C18H28ClNO and a molecular weight of 309.88 g/mol. Its IUPAC name is (Z,3R,4R)-1-(2-chlorophenyl)-4-[(dimethylamino)methyl]non-1-en-3-ol.
| Compound Name | (Z,3R,4R)-1-(2-chlorophenyl)-4-[(dimethylamino)methyl]non-1-en-3-ol |
|---|---|
| PubChem CID | 98523239 |
| Molecular Formula | C18H28ClNO |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (Z,3R,4R)-1-(2-chlorophenyl)-4-[(dimethylamino)methyl]non-1-en-3-ol |
| SMILES | CCCCC[C@H](CN(C)C)[C@H](O)/C=C\c1ccccc1Cl |
| InChI | InChI=1S/C18H28ClNO/c1-4-5-6-10-16(14-20(2)3)18(21)13-12-15-9-7-8-11-17(15)19/h7-9,11-13,16,18,21H,4-6,10,14H2,1-3H3/b13-12-/t16-,18-/m1/s1 |
| InChIKey | JWECFDHHHFPOGP-VKJYAMAFSA-N |
| XLogP | 4.47 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|