C35H41NO3 — CID 10414447
2-[2-tert-butyl-6-[(E)-2-[4-[2-ethylhexyl(methyl)amino]phenyl]ethenyl]pyran-4-ylidene]indene-1,3-dione (PubChem CID 10414447) has the molecular formula C35H41NO3 and a molecular weight of 523.72 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-[(E)-2-[4-[2-ethylhexyl(methyl)amino]phenyl]ethenyl]pyran-4-ylidene]indene-1,3-dione.
| Compound Name | 2-[2-tert-butyl-6-[(E)-2-[4-[2-ethylhexyl(methyl)amino]phenyl]ethenyl]pyran-4-ylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 10414447 |
| Molecular Formula | C35H41NO3 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.31 |
| IUPAC Name | 2-[2-tert-butyl-6-[(E)-2-[4-[2-ethylhexyl(methyl)amino]phenyl]ethenyl]pyran-4-ylidene]indene-1,3-dione |
| SMILES | CCCCC(CC)CN(C)c1ccc(/C=C/C2=CC(=C3C(=O)c4ccccc4C3=O)C=C(C(C)(C)C)O2)cc1 |
| InChI | InChI=1S/C35H41NO3/c1-7-9-12-24(8-2)23-36(6)27-18-15-25(16-19-27)17-20-28-21-26(22-31(39-28)35(3,4)5)32-33(37)29-13-10-11-14-30(29)34(32)38/h10-11,13-22,24H,7-9,12,23H2,1-6H3/b20-17+ |
| InChIKey | RYERJCFVXAZBMX-LVZFUZTISA-N |
| XLogP | 8.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|