C33H36N4O4 — CID 59032472
5-[2,6-bis[2-[4-(dimethylamino)phenyl]ethenyl]pyran-4-ylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione (PubChem CID 59032472) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 5-[2,6-bis[2-[4-(dimethylamino)phenyl]ethenyl]pyran-4-ylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[2,6-bis[2-[4-(dimethylamino)phenyl]ethenyl]pyran-4-ylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 59032472 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 5-[2,6-bis[2-[4-(dimethylamino)phenyl]ethenyl]pyran-4-ylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1C(=O)C(=C2C=C(C=Cc3ccc(N(C)C)cc3)OC(C=Cc3ccc(N(C)C)cc3)=C2)C(=O)N(CC)C1=O |
| InChI | InChI=1S/C33H36N4O4/c1-7-36-31(38)30(32(39)37(8-2)33(36)40)25-21-28(19-13-23-9-15-26(16-10-23)34(3)4)41-29(22-25)20-14-24-11-17-27(18-12-24)35(5)6/h9-22H,7-8H2,1-6H3 |
| InChIKey | BGGGKICKJXIDRN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|