C38H39N3O3 — CID 101462751
4-[2,6-bis[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyran-4-ylidene]-3-phenyl-1,2-oxazol-5-one (PubChem CID 101462751) has the molecular formula C38H39N3O3 and a molecular weight of 585.75 g/mol. Its IUPAC name is 4-[2,6-bis[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyran-4-ylidene]-3-phenyl-1,2-oxazol-5-one.
| Compound Name | 4-[2,6-bis[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyran-4-ylidene]-3-phenyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 101462751 |
| Molecular Formula | C38H39N3O3 |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | 4-[2,6-bis[(E)-2-[4-(diethylamino)phenyl]ethenyl]pyran-4-ylidene]-3-phenyl-1,2-oxazol-5-one |
| SMILES | CCN(CC)c1ccc(/C=C/C2=CC(=C3C(=O)ON=C3c3ccccc3)C=C(/C=C/c3ccc(N(CC)CC)cc3)O2)cc1 |
| InChI | InChI=1S/C38H39N3O3/c1-5-40(6-2)32-20-14-28(15-21-32)18-24-34-26-31(36-37(39-44-38(36)42)30-12-10-9-11-13-30)27-35(43-34)25-19-29-16-22-33(23-17-29)41(7-3)8-4/h9-27H,5-8H2,1-4H3/b24-18+,25-19+ |
| InChIKey | QMJFAHIFZYMCPR-SIHVKLMXSA-N |
| XLogP | 8.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|