C37H29N3O3 — CID 23386609
4-[2-[(E)-2-(9-ethylcarbazol-3-yl)ethenyl]-6-methylpyran-4-ylidene]-1,2-diphenylpyrazolidine-3,5-dione (PubChem CID 23386609) has the molecular formula C37H29N3O3 and a molecular weight of 563.66 g/mol. Its IUPAC name is 4-[2-[(E)-2-(9-ethylcarbazol-3-yl)ethenyl]-6-methylpyran-4-ylidene]-1,2-diphenylpyrazolidine-3,5-dione.
| Compound Name | 4-[2-[(E)-2-(9-ethylcarbazol-3-yl)ethenyl]-6-methylpyran-4-ylidene]-1,2-diphenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 23386609 |
| Molecular Formula | C37H29N3O3 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 4-[2-[(E)-2-(9-ethylcarbazol-3-yl)ethenyl]-6-methylpyran-4-ylidene]-1,2-diphenylpyrazolidine-3,5-dione |
| SMILES | CCn1c2ccccc2c2cc(/C=C/C3=CC(=C4C(=O)N(c5ccccc5)N(c5ccccc5)C4=O)C=C(C)O3)ccc21 |
| InChI | InChI=1S/C37H29N3O3/c1-3-38-33-17-11-10-16-31(33)32-23-26(19-21-34(32)38)18-20-30-24-27(22-25(2)43-30)35-36(41)39(28-12-6-4-7-13-28)40(37(35)42)29-14-8-5-9-15-29/h4-24H,3H2,1-2H3/b20-18+ |
| InChIKey | FUJNSPKZWQZUNG-CZIZESTLSA-N |
| XLogP | 7.94 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|