C26H23N3O2 — CID 58958967
(5E)-3-ethyl-5-[(9-ethylcarbazol-3-yl)methylidene]-2-phenylimino-1,3-oxazolidin-4-one (PubChem CID 58958967) has the molecular formula C26H23N3O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is (5E)-3-ethyl-5-[(9-ethylcarbazol-3-yl)methylidene]-2-phenylimino-1,3-oxazolidin-4-one.
| Compound Name | (5E)-3-ethyl-5-[(9-ethylcarbazol-3-yl)methylidene]-2-phenylimino-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 58958967 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (5E)-3-ethyl-5-[(9-ethylcarbazol-3-yl)methylidene]-2-phenylimino-1,3-oxazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc3c(c2)c2ccccc2n3CC)O/C1=N\c1ccccc1 |
| InChI | InChI=1S/C26H23N3O2/c1-3-28-22-13-9-8-12-20(22)21-16-18(14-15-23(21)28)17-24-25(30)29(4-2)26(31-24)27-19-10-6-5-7-11-19/h5-17H,3-4H2,1-2H3/b24-17+,27-26- |
| InChIKey | GZRCCUDQLHNDGY-UINIZAEWSA-N |
| XLogP | 5.72 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|