C36H33N3O5 — CID 58958964
ethyl 4-[[(5E)-3-[(4-ethoxyphenyl)methyl]-5-[(9-ethylcarbazol-3-yl)methylidene]-4-oxo-1,3-oxazolidin-2-ylidene]amino]benzoate (PubChem CID 58958964) has the molecular formula C36H33N3O5 and a molecular weight of 587.68 g/mol. Its IUPAC name is ethyl 4-[[(5E)-3-[(4-ethoxyphenyl)methyl]-5-[(9-ethylcarbazol-3-yl)methylidene]-4-oxo-1,3-oxazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5E)-3-[(4-ethoxyphenyl)methyl]-5-[(9-ethylcarbazol-3-yl)methylidene]-4-oxo-1,3-oxazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 58958964 |
| Molecular Formula | C36H33N3O5 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | ethyl 4-[[(5E)-3-[(4-ethoxyphenyl)methyl]-5-[(9-ethylcarbazol-3-yl)methylidene]-4-oxo-1,3-oxazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2\O/C(=C/c3ccc4c(c3)c3ccccc3n4CC)C(=O)N2Cc2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C36H33N3O5/c1-4-38-31-10-8-7-9-29(31)30-21-25(13-20-32(30)38)22-33-34(40)39(23-24-11-18-28(19-12-24)42-5-2)36(44-33)37-27-16-14-26(15-17-27)35(41)43-6-3/h7-22H,4-6,23H2,1-3H3/b33-22+,37-36- |
| InChIKey | SPBGFAIZBQKMCU-GSWUPSMCSA-N |
| XLogP | 7.48 |
| TPSA | 82.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|