C28H24N2O3S — CID 135927064
ethyl (5Z)-5-[(9-ethylcarbazol-3-yl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate (PubChem CID 135927064) has the molecular formula C28H24N2O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is ethyl (5Z)-5-[(9-ethylcarbazol-3-yl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(9-ethylcarbazol-3-yl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135927064 |
| Molecular Formula | C28H24N2O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | ethyl (5Z)-5-[(9-ethylcarbazol-3-yl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2ccc3c(c2)c2ccccc2n3CC)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C28H24N2O3S/c1-3-30-22-13-9-8-12-20(22)21-16-18(14-15-23(21)30)17-24-26(31)25(28(32)33-4-2)27(34-24)29-19-10-6-5-7-11-19/h5-17,31H,3-4H2,1-2H3/b24-17-,29-27- |
| InChIKey | GAMLIDQTYIGZJU-JTGJOCGUSA-N |
| XLogP | 7.01 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|