C22H19BrINO4S — CID 137120539
ethyl (5Z)-5-[(3-bromo-4-ethoxy-5-iodophenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate (PubChem CID 137120539) has the molecular formula C22H19BrINO4S and a molecular weight of 600.27 g/mol. Its IUPAC name is ethyl (5Z)-5-[(3-bromo-4-ethoxy-5-iodophenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(3-bromo-4-ethoxy-5-iodophenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137120539 |
| Molecular Formula | C22H19BrINO4S |
| Molecular Weight | 600.27 g/mol |
| Exact Mass | 598.93 |
| IUPAC Name | ethyl (5Z)-5-[(3-bromo-4-ethoxy-5-iodophenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(Br)c(OCC)c(I)c2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C22H19BrINO4S/c1-3-28-20-15(23)10-13(11-16(20)24)12-17-19(26)18(22(27)29-4-2)21(30-17)25-14-8-6-5-7-9-14/h5-12,26H,3-4H2,1-2H3/b17-12-,25-21- |
| InChIKey | BTPYCWOHRPQBEG-FJUVEKCXSA-N |
| XLogP | 6.65 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.27 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|