C23H19I2NO6S — CID 137120579
ethyl (5Z)-5-[[3,5-diiodo-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate (PubChem CID 137120579) has the molecular formula C23H19I2NO6S and a molecular weight of 691.28 g/mol. Its IUPAC name is ethyl (5Z)-5-[[3,5-diiodo-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[3,5-diiodo-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137120579 |
| Molecular Formula | C23H19I2NO6S |
| Molecular Weight | 691.28 g/mol |
| Exact Mass | 690.90 |
| IUPAC Name | ethyl (5Z)-5-[[3,5-diiodo-4-(2-methoxy-2-oxoethoxy)phenyl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(I)c(OCC(=O)OC)c(I)c2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C23H19I2NO6S/c1-3-31-23(29)19-20(28)17(33-22(19)26-14-7-5-4-6-8-14)11-13-9-15(24)21(16(25)10-13)32-12-18(27)30-2/h4-11,28H,3,12H2,1-2H3/b17-11-,26-22- |
| InChIKey | PXHIAKGFKWEGGA-NSUQGKCESA-N |
| XLogP | 5.64 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.28 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|