C25H22INO5S — CID 137120817
ethyl (5Z)-5-[(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate (PubChem CID 137120817) has the molecular formula C25H22INO5S and a molecular weight of 575.42 g/mol. Its IUPAC name is ethyl (5Z)-5-[(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137120817 |
| Molecular Formula | C25H22INO5S |
| Molecular Weight | 575.42 g/mol |
| Exact Mass | 575.03 |
| IUPAC Name | ethyl (5Z)-5-[(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| SMILES | C#CCOc1c(I)cc(/C=C2\S/C(=N\c3ccccc3)C(C(=O)OCC)=C2O)cc1OCC |
| InChI | InChI=1S/C25H22INO5S/c1-4-12-32-23-18(26)13-16(14-19(23)30-5-2)15-20-22(28)21(25(29)31-6-3)24(33-20)27-17-10-8-7-9-11-17/h1,7-11,13-15,28H,5-6,12H2,2-3H3/b20-15-,27-24- |
| InChIKey | BRKAHUGKAQPBRS-GVIDBFLSSA-N |
| XLogP | 5.89 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|