C26H26INO6S — CID 137170551
ethyl (5Z)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate (PubChem CID 137170551) has the molecular formula C26H26INO6S and a molecular weight of 607.47 g/mol. Its IUPAC name is ethyl (5Z)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137170551 |
| Molecular Formula | C26H26INO6S |
| Molecular Weight | 607.47 g/mol |
| Exact Mass | 607.05 |
| IUPAC Name | ethyl (5Z)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-4-hydroxy-2-(2-methylbenzoyl)iminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(I)c(OCC)c(OCC)c2)S/C1=N\C(=O)c1ccccc1C |
| InChI | InChI=1S/C26H26INO6S/c1-5-32-19-13-16(12-18(27)23(19)33-6-2)14-20-22(29)21(26(31)34-7-3)25(35-20)28-24(30)17-11-9-8-10-15(17)4/h8-14,29H,5-7H2,1-4H3/b20-14-,28-25- |
| InChIKey | GICZABDKGAFSAQ-ARIIHFJZSA-N |
| XLogP | 6.10 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.47 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|