C27H24INO6S — CID 135521851
ethyl (5Z)-5-[(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-(4-methylbenzoyl)iminothiophene-3-carboxylate (PubChem CID 135521851) has the molecular formula C27H24INO6S and a molecular weight of 617.46 g/mol. Its IUPAC name is ethyl (5Z)-5-[(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-(4-methylbenzoyl)iminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-(4-methylbenzoyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135521851 |
| Molecular Formula | C27H24INO6S |
| Molecular Weight | 617.46 g/mol |
| Exact Mass | 617.04 |
| IUPAC Name | ethyl (5Z)-5-[(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylidene]-4-hydroxy-2-(4-methylbenzoyl)iminothiophene-3-carboxylate |
| SMILES | C#CCOc1c(I)cc(/C=C2\S/C(=N\C(=O)c3ccc(C)cc3)C(C(=O)OCC)=C2O)cc1OCC |
| InChI | InChI=1S/C27H24INO6S/c1-5-12-35-24-19(28)13-17(14-20(24)33-6-2)15-21-23(30)22(27(32)34-7-3)26(36-21)29-25(31)18-10-8-16(4)9-11-18/h1,8-11,13-15,30H,6-7,12H2,2-4H3/b21-15-,29-26- |
| InChIKey | ILQAWXVBCCPYST-FJHSNONLSA-N |
| XLogP | 5.71 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|