C24H19NO5S — CID 135521866
ethyl (5Z)-2-benzoylimino-4-hydroxy-5-[(4-prop-2-ynoxyphenyl)methylidene]thiophene-3-carboxylate (PubChem CID 135521866) has the molecular formula C24H19NO5S and a molecular weight of 433.49 g/mol. Its IUPAC name is ethyl (5Z)-2-benzoylimino-4-hydroxy-5-[(4-prop-2-ynoxyphenyl)methylidene]thiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-benzoylimino-4-hydroxy-5-[(4-prop-2-ynoxyphenyl)methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 135521866 |
| Molecular Formula | C24H19NO5S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | ethyl (5Z)-2-benzoylimino-4-hydroxy-5-[(4-prop-2-ynoxyphenyl)methylidene]thiophene-3-carboxylate |
| SMILES | C#CCOc1ccc(/C=C2\S/C(=N\C(=O)c3ccccc3)C(C(=O)OCC)=C2O)cc1 |
| InChI | InChI=1S/C24H19NO5S/c1-3-14-30-18-12-10-16(11-13-18)15-19-21(26)20(24(28)29-4-2)23(31-19)25-22(27)17-8-6-5-7-9-17/h1,5-13,15,26H,4,14H2,2H3/b19-15-,25-23- |
| InChIKey | TWPGZCYAWALPMO-FKXKMJGMSA-N |
| XLogP | 4.40 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|