C23H19Cl2NO5S — CID 137171044
ethyl (5Z)-2-benzoylimino-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate (PubChem CID 137171044) has the molecular formula C23H19Cl2NO5S and a molecular weight of 492.38 g/mol. Its IUPAC name is ethyl (5Z)-2-benzoylimino-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-benzoylimino-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 137171044 |
| Molecular Formula | C23H19Cl2NO5S |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | ethyl (5Z)-2-benzoylimino-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(Cl)c(OCC)c(Cl)c2)S/C1=N\C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19Cl2NO5S/c1-3-30-20-15(24)10-13(11-16(20)25)12-17-19(27)18(23(29)31-4-2)22(32-17)26-21(28)14-8-6-5-7-9-14/h5-12,27H,3-4H2,1-2H3/b17-12-,26-22- |
| InChIKey | JETMMUXMUUKSFW-OTNSQLAVSA-N |
| XLogP | 6.09 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|