C25H22ClNO6S — CID 135402601
ethyl (5Z)-2-benzoylimino-5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate (PubChem CID 135402601) has the molecular formula C25H22ClNO6S and a molecular weight of 499.97 g/mol. Its IUPAC name is ethyl (5Z)-2-benzoylimino-5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-benzoylimino-5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 135402601 |
| Molecular Formula | C25H22ClNO6S |
| Molecular Weight | 499.97 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | ethyl (5Z)-2-benzoylimino-5-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate |
| SMILES | C=CCOc1c(Cl)cc(/C=C2\S/C(=N\C(=O)c3ccccc3)C(C(=O)OCC)=C2O)cc1OC |
| InChI | InChI=1S/C25H22ClNO6S/c1-4-11-33-22-17(26)12-15(13-18(22)31-3)14-19-21(28)20(25(30)32-5-2)24(34-19)27-23(29)16-9-7-6-8-10-16/h4,6-10,12-14,28H,1,5,11H2,2-3H3/b19-14-,27-24- |
| InChIKey | IBNOEGGHYDIITK-RMXGTQLISA-N |
| XLogP | 5.62 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.97 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|