C21H15Cl2NO5S — CID 137170816
ethyl (5Z)-2-benzoylimino-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate (PubChem CID 137170816) has the molecular formula C21H15Cl2NO5S and a molecular weight of 464.33 g/mol. Its IUPAC name is ethyl (5Z)-2-benzoylimino-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-benzoylimino-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 137170816 |
| Molecular Formula | C21H15Cl2NO5S |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | ethyl (5Z)-2-benzoylimino-5-[(3,5-dichloro-4-hydroxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(Cl)c(O)c(Cl)c2)S/C1=N\C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H15Cl2NO5S/c1-2-29-21(28)16-18(26)15(10-11-8-13(22)17(25)14(23)9-11)30-20(16)24-19(27)12-6-4-3-5-7-12/h3-10,25-26H,2H2,1H3/b15-10-,24-20- |
| InChIKey | ISCOCCVJUUMEFN-KLRSOGAQSA-N |
| XLogP | 5.40 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|