C22H19NO6S — CID 137137830
ethyl (5Z)-2-benzoylimino-4-hydroxy-5-[(4-hydroxy-3-methoxyphenyl)methylidene]thiophene-3-carboxylate (PubChem CID 137137830) has the molecular formula C22H19NO6S and a molecular weight of 425.46 g/mol. Its IUPAC name is ethyl (5Z)-2-benzoylimino-4-hydroxy-5-[(4-hydroxy-3-methoxyphenyl)methylidene]thiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-benzoylimino-4-hydroxy-5-[(4-hydroxy-3-methoxyphenyl)methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 137137830 |
| Molecular Formula | C22H19NO6S |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | ethyl (5Z)-2-benzoylimino-4-hydroxy-5-[(4-hydroxy-3-methoxyphenyl)methylidene]thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2ccc(O)c(OC)c2)S/C1=N\C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19NO6S/c1-3-29-22(27)18-19(25)17(12-13-9-10-15(24)16(11-13)28-2)30-21(18)23-20(26)14-7-5-4-6-8-14/h4-12,24-25H,3H2,1-2H3/b17-12-,23-21- |
| InChIKey | SZYONELPVTWFCD-FTONFVTGSA-N |
| XLogP | 4.10 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|