C23H20BrNO6S — CID 136715530
ethyl (5E)-2-benzoylimino-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate (PubChem CID 136715530) has the molecular formula C23H20BrNO6S and a molecular weight of 518.39 g/mol. Its IUPAC name is ethyl (5E)-2-benzoylimino-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl (5E)-2-benzoylimino-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 136715530 |
| Molecular Formula | C23H20BrNO6S |
| Molecular Weight | 518.39 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | ethyl (5E)-2-benzoylimino-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C\c2cc(Br)c(OC)cc2OC)S/C1=N\C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H20BrNO6S/c1-4-31-23(28)19-20(26)18(11-14-10-15(24)17(30-3)12-16(14)29-2)32-22(19)25-21(27)13-8-6-5-7-9-13/h5-12,26H,4H2,1-3H3/b18-11+,25-22- |
| InChIKey | OUVKCBCSDHZEDV-ALBOWHDUSA-N |
| XLogP | 5.17 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|