C23H21NO6S — CID 137170522
ethyl (5Z)-2-benzoylimino-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate (PubChem CID 137170522) has the molecular formula C23H21NO6S and a molecular weight of 439.49 g/mol. Its IUPAC name is ethyl (5Z)-2-benzoylimino-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-benzoylimino-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 137170522 |
| Molecular Formula | C23H21NO6S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | ethyl (5Z)-2-benzoylimino-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-4-hydroxythiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2ccc(O)c(OCC)c2)S/C1=N\C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21NO6S/c1-3-29-17-12-14(10-11-16(17)25)13-18-20(26)19(23(28)30-4-2)22(31-18)24-21(27)15-8-6-5-7-9-15/h5-13,25-26H,3-4H2,1-2H3/b18-13-,24-22- |
| InChIKey | HWTTZMSOFSSWLO-OCXHRERVSA-N |
| XLogP | 4.49 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|