C34H29NO6S — CID 135496725
ethyl 2-benzoylimino-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-hydroxythiophene-3-carboxylate (PubChem CID 135496725) has the molecular formula C34H29NO6S and a molecular weight of 579.67 g/mol. Its IUPAC name is ethyl 2-benzoylimino-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl 2-benzoylimino-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 135496725 |
| Molecular Formula | C34H29NO6S |
| Molecular Weight | 579.67 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | ethyl 2-benzoylimino-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-hydroxythiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=Cc2ccc(OCc3cccc4ccccc34)c(OCC)c2)S/C1=N\C(=O)c1ccccc1 |
| InChI | InChI=1S/C34H29NO6S/c1-3-39-28-19-22(17-18-27(28)41-21-25-15-10-14-23-11-8-9-16-26(23)25)20-29-31(36)30(34(38)40-4-2)33(42-29)35-32(37)24-12-6-5-7-13-24/h5-20,36H,3-4,21H2,1-2H3/b29-20?,35-33- |
| InChIKey | NHOFRXMKBNOEKS-CHUMVBLBSA-N |
| XLogP | 7.52 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.67 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|