C30H28INO6S — CID 137027455
ethyl (5Z)-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate (PubChem CID 137027455) has the molecular formula C30H28INO6S and a molecular weight of 657.53 g/mol. Its IUPAC name is ethyl (5Z)-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137027455 |
| Molecular Formula | C30H28INO6S |
| Molecular Weight | 657.53 g/mol |
| Exact Mass | 657.07 |
| IUPAC Name | ethyl (5Z)-5-[[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-hydroxy-2-propanoyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cc(I)c(OCc3cccc4ccccc34)c(OCC)c2)S/C1=N\C(=O)CC |
| InChI | InChI=1S/C30H28INO6S/c1-4-25(33)32-29-26(30(35)37-6-3)27(34)24(39-29)16-18-14-22(31)28(23(15-18)36-5-2)38-17-20-12-9-11-19-10-7-8-13-21(19)20/h7-16,34H,4-6,17H2,1-3H3/b24-16-,32-29- |
| InChIKey | KWQQWQAQMMWLOC-XXGXLLGDSA-N |
| XLogP | 7.22 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.53 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|