C27H26Cl2INO6S — CID 137027337
ethyl (5Z)-2-butanoylimino-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-4-hydroxythiophene-3-carboxylate (PubChem CID 137027337) has the molecular formula C27H26Cl2INO6S and a molecular weight of 690.38 g/mol. Its IUPAC name is ethyl (5Z)-2-butanoylimino-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-butanoylimino-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 137027337 |
| Molecular Formula | C27H26Cl2INO6S |
| Molecular Weight | 690.38 g/mol |
| Exact Mass | 688.99 |
| IUPAC Name | ethyl (5Z)-2-butanoylimino-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-4-hydroxythiophene-3-carboxylate |
| SMILES | CCCC(=O)/N=C1\S/C(=C\c2cc(I)c(OCc3ccc(Cl)cc3Cl)c(OCC)c2)C(O)=C1C(=O)OCC |
| InChI | InChI=1S/C27H26Cl2INO6S/c1-4-7-22(32)31-26-23(27(34)36-6-3)24(33)21(38-26)12-15-10-19(30)25(20(11-15)35-5-2)37-14-16-8-9-17(28)13-18(16)29/h8-13,33H,4-7,14H2,1-3H3/b21-12-,31-26- |
| InChIKey | CLCWOXRHVVIGGH-CIYYLQGBSA-N |
| XLogP | 7.76 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.38 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|